C12H8F3N3O2 — CID 116812899
N-[(2,4-difluoro-5-nitrophenyl)methyl]-6-fluoropyridin-2-amine (PubChem CID 116812899) has the molecular formula C12H8F3N3O2 and a molecular weight of 283.21 g/mol. Its IUPAC name is N-[(2,4-difluoro-5-nitrophenyl)methyl]-6-fluoropyridin-2-amine.
| Compound Name | N-[(2,4-difluoro-5-nitrophenyl)methyl]-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 116812899 |
| Molecular Formula | C12H8F3N3O2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-[(2,4-difluoro-5-nitrophenyl)methyl]-6-fluoropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(CNc2cccc(F)n2)c(F)cc1F |
| InChI | InChI=1S/C12H8F3N3O2/c13-8-5-9(14)10(18(19)20)4-7(8)6-16-12-3-1-2-11(15)17-12/h1-5H,6H2,(H,16,17) |
| InChIKey | UNUCMJRCQWOZDL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|