C13H11FN2O3S — CID 116814254
2-[(2-pyridin-3-ylacetyl)amino]benzenesulfonyl fluoride (PubChem CID 116814254) has the molecular formula C13H11FN2O3S and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[(2-pyridin-3-ylacetyl)amino]benzenesulfonyl fluoride.
| Compound Name | 2-[(2-pyridin-3-ylacetyl)amino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 116814254 |
| Molecular Formula | C13H11FN2O3S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-[(2-pyridin-3-ylacetyl)amino]benzenesulfonyl fluoride |
| SMILES | O=C(Cc1cccnc1)Nc1ccccc1S(=O)(=O)F |
| InChI | InChI=1S/C13H11FN2O3S/c14-20(18,19)12-6-2-1-5-11(12)16-13(17)8-10-4-3-7-15-9-10/h1-7,9H,8H2,(H,16,17) |
| InChIKey | YMRSRCRXJJGUAH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |