C13H14FNO4S — CID 116816847
(E)-3-[5-(1,1-dioxothiazinan-2-yl)-2-fluorophenyl]prop-2-enoic acid (PubChem CID 116816847) has the molecular formula C13H14FNO4S and a molecular weight of 299.32 g/mol. Its IUPAC name is (E)-3-[5-(1,1-dioxothiazinan-2-yl)-2-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(1,1-dioxothiazinan-2-yl)-2-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 116816847 |
| Molecular Formula | C13H14FNO4S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (E)-3-[5-(1,1-dioxothiazinan-2-yl)-2-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(N2CCCCS2(=O)=O)ccc1F |
| InChI | InChI=1S/C13H14FNO4S/c14-12-5-4-11(9-10(12)3-6-13(16)17)15-7-1-2-8-20(15,18)19/h3-6,9H,1-2,7-8H2,(H,16,17)/b6-3+ |
| InChIKey | LANAFRBHPMPNAC-ZZXKWVIFSA-N |
| XLogP | 1.85 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|