C12H13NO6S — CID 116814423
5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid (PubChem CID 116814423) has the molecular formula C12H13NO6S and a molecular weight of 299.30 g/mol. Its IUPAC name is 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 116814423 |
| Molecular Formula | C12H13NO6S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C12H13NO6S/c14-11(15)8-5-9(12(16)17)7-10(6-8)13-3-1-2-4-20(13,18)19/h5-7H,1-4H2,(H,14,15)(H,16,17) |
| InChIKey | FZYNPFBZFZFBHK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |