5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid

C12H13NO6S — CID 116814423

IUPAC5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)cc(N2CCCCS2(=O)=O)c1
InChIInChI=1S/C12H13NO6S/c14-11(15)8-5-9(12(16)17)7-10(6-8)13-3-1-2-4-20(13,18)19/h5-7H,1-4H2,(H,14,15)(H,16,17)
InChIKeyFZYNPFBZFZFBHK-UHFFFAOYSA-N
MW299.30 g/mol
LogP1.01
Rot. Bonds3

About 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid

5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid (PubChem CID 116814423) has the molecular formula C12H13NO6S and a molecular weight of 299.30 g/mol. Its IUPAC name is 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid
PubChem CID116814423
Molecular FormulaC12H13NO6S
Molecular Weight299.30 g/mol
Exact Mass299.05
IUPAC Name5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)cc(N2CCCCS2(=O)=O)c1
InChIInChI=1S/C12H13NO6S/c14-11(15)8-5-9(12(16)17)7-10(6-8)13-3-1-2-4-20(13,18)19/h5-7H,1-4H2,(H,14,15)(H,16,17)
InChIKeyFZYNPFBZFZFBHK-UHFFFAOYSA-N
XLogP1.01
TPSA111.98 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.30
LogP ≤ 51.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid?
The IUPAC name of 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid (CID 116814423) is 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid?
The canonical SMILES for 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid is O=C(O)c1cc(C(=O)O)cc(N2CCCCS2(=O)=O)c1.
What is the InChIKey of 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid?
The InChIKey is FZYNPFBZFZFBHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO6S/c14-11(15)8-5-9(12(16)17)7-10(6-8)13-3-1-2-4-20(13,18)19/h5-7H,1-4H2,(H,14,15)(H,16,17).
What are the key properties of 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid?
5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid has a molecular weight of 299.30 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-dioxothiazinan-2-yl)benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 116814423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).