C17H21NO4S — CID 69358817
methyl 3-cyclopent-3-en-1-yl-5-(1,1-dioxothiazinan-2-yl)benzoate (PubChem CID 69358817) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is methyl 3-cyclopent-3-en-1-yl-5-(1,1-dioxothiazinan-2-yl)benzoate.
| Compound Name | methyl 3-cyclopent-3-en-1-yl-5-(1,1-dioxothiazinan-2-yl)benzoate |
|---|---|
| PubChem CID | 69358817 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | methyl 3-cyclopent-3-en-1-yl-5-(1,1-dioxothiazinan-2-yl)benzoate |
| SMILES | COC(=O)c1cc(C2CC=CC2)cc(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C17H21NO4S/c1-22-17(19)15-10-14(13-6-2-3-7-13)11-16(12-15)18-8-4-5-9-23(18,20)21/h2-3,10-13H,4-9H2,1H3 |
| InChIKey | XHJLQGNRCMZJTJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|