3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid

C11H12INO4S — CID 112750124

IUPAC3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid
SMILESO=C(O)c1cc(I)cc(N2CCCCS2(=O)=O)c1
InChIInChI=1S/C11H12INO4S/c12-9-5-8(11(14)15)6-10(7-9)13-3-1-2-4-18(13,16)17/h5-7H,1-4H2,(H,14,15)
InChIKeyGABQSMSCILOIRJ-UHFFFAOYSA-N
MW381.19 g/mol
LogP1.92
Rot. Bonds2

About 3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid

3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid (PubChem CID 112750124) has the molecular formula C11H12INO4S and a molecular weight of 381.19 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid.

Molecular Properties

Compound Name3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid
PubChem CID112750124
Molecular FormulaC11H12INO4S
Molecular Weight381.19 g/mol
Exact Mass380.95
IUPAC Name3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid
SMILESO=C(O)c1cc(I)cc(N2CCCCS2(=O)=O)c1
InChIInChI=1S/C11H12INO4S/c12-9-5-8(11(14)15)6-10(7-9)13-3-1-2-4-18(13,16)17/h5-7H,1-4H2,(H,14,15)
InChIKeyGABQSMSCILOIRJ-UHFFFAOYSA-N
XLogP1.92
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500381.19
LogP ≤ 51.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid?
The IUPAC name of 3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid (CID 112750124) is 3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid.
What is the SMILES notation for 3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid?
The canonical SMILES for 3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid is O=C(O)c1cc(I)cc(N2CCCCS2(=O)=O)c1.
What is the InChIKey of 3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid?
The InChIKey is GABQSMSCILOIRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12INO4S/c12-9-5-8(11(14)15)6-10(7-9)13-3-1-2-4-18(13,16)17/h5-7H,1-4H2,(H,14,15).
What are the key properties of 3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid?
3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid has a molecular weight of 381.19 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothiazinan-2-yl)-5-iodobenzoic acid is sourced from PubChem (CID 112750124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).