C12H15NO4S — CID 82514494
2-[4-(1,1-dioxothiazinan-2-yl)phenyl]acetic acid (PubChem CID 82514494) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-[4-(1,1-dioxothiazinan-2-yl)phenyl]acetic acid.
| Compound Name | 2-[4-(1,1-dioxothiazinan-2-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 82514494 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-[4-(1,1-dioxothiazinan-2-yl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(N2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C12H15NO4S/c14-12(15)9-10-3-5-11(6-4-10)13-7-1-2-8-18(13,16)17/h3-6H,1-2,7-9H2,(H,14,15) |
| InChIKey | QICITQWLRDLORQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |