5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid

C9H7ClN4O2 — CID 116817604

IUPAC5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid
SMILESNc1nc(C(=O)O)nn1-c1ccc(Cl)cc1
InChIInChI=1S/C9H7ClN4O2/c10-5-1-3-6(4-2-5)14-9(11)12-7(13-14)8(15)16/h1-4H,(H,15,16)(H2,11,12,13)
InChIKeyRXGZEWZWXVYEGJ-UHFFFAOYSA-N
MW238.63 g/mol
LogP1.20
Rot. Bonds2

About 5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid

5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid (PubChem CID 116817604) has the molecular formula C9H7ClN4O2 and a molecular weight of 238.63 g/mol. Its IUPAC name is 5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid.

Molecular Properties

Compound Name5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid
PubChem CID116817604
Molecular FormulaC9H7ClN4O2
Molecular Weight238.63 g/mol
Exact Mass238.03
IUPAC Name5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid
SMILESNc1nc(C(=O)O)nn1-c1ccc(Cl)cc1
InChIInChI=1S/C9H7ClN4O2/c10-5-1-3-6(4-2-5)14-9(11)12-7(13-14)8(15)16/h1-4H,(H,15,16)(H2,11,12,13)
InChIKeyRXGZEWZWXVYEGJ-UHFFFAOYSA-N
XLogP1.20
TPSA94.03 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.63
LogP ≤ 51.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid (CID 116817604) is 5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid is Nc1nc(C(=O)O)nn1-c1ccc(Cl)cc1.
What is the InChIKey of 5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid?
The InChIKey is RXGZEWZWXVYEGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN4O2/c10-5-1-3-6(4-2-5)14-9(11)12-7(13-14)8(15)16/h1-4H,(H,15,16)(H2,11,12,13).
What are the key properties of 5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid?
5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid has a molecular weight of 238.63 g/mol, XLogP of 1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(4-chlorophenyl)-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 116817604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).