C13H16ClN3 — CID 116818139
2-[1-(3-chloro-4-methylphenyl)pyrazol-3-yl]-N-methylethanamine (PubChem CID 116818139) has the molecular formula C13H16ClN3 and a molecular weight of 249.75 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-methylphenyl)pyrazol-3-yl]-N-methylethanamine.
| Compound Name | 2-[1-(3-chloro-4-methylphenyl)pyrazol-3-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 116818139 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.75 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-[1-(3-chloro-4-methylphenyl)pyrazol-3-yl]-N-methylethanamine |
| SMILES | CNCCc1ccn(-c2ccc(C)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H16ClN3/c1-10-3-4-12(9-13(10)14)17-8-6-11(16-17)5-7-15-2/h3-4,6,8-9,15H,5,7H2,1-2H3 |
| InChIKey | SJVMVAHTYLPEML-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.75 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |