C17H21Cl2N3 — CID 162119357
1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine (PubChem CID 162119357) has the molecular formula C17H21Cl2N3 and a molecular weight of 338.28 g/mol. Its IUPAC name is 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine.
| Compound Name | 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine |
|---|---|
| PubChem CID | 162119357 |
| Molecular Formula | C17H21Cl2N3 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine |
| SMILES | Clc1ccc(-n2ccc(CCCN3CCCCC3)n2)cc1Cl |
| InChI | InChI=1S/C17H21Cl2N3/c18-16-7-6-15(13-17(16)19)22-12-8-14(20-22)5-4-11-21-9-2-1-3-10-21/h6-8,12-13H,1-5,9-11H2 |
| InChIKey | ZHEWLZPYKIBPDP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |