About 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine
1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine (PubChem CID 162119357) has the molecular formula C17H21Cl2N3
and a molecular weight of 338.28 g/mol. Its IUPAC name is 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine.
Molecular Properties
| Compound Name | 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine |
| PubChem CID | 162119357 |
| Molecular Formula | C17H21Cl2N3 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine |
| SMILES | Clc1ccc(-n2ccc(CCCN3CCCCC3)n2)cc1Cl |
| InChI | InChI=1S/C17H21Cl2N3/c18-16-7-6-15(13-17(16)19)22-12-8-14(20-22)5-4-11-21-9-2-1-3-10-21/h6-8,12-13H,1-5,9-11H2 |
| InChIKey | ZHEWLZPYKIBPDP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine?
The IUPAC name of 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine (CID 162119357) is 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine.
What is the SMILES notation for 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine?
The canonical SMILES for 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine is Clc1ccc(-n2ccc(CCCN3CCCCC3)n2)cc1Cl.
What is the InChIKey of 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine?
The InChIKey is ZHEWLZPYKIBPDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21Cl2N3/c18-16-7-6-15(13-17(16)19)22-12-8-14(20-22)5-4-11-21-9-2-1-3-10-21/h6-8,12-13H,1-5,9-11H2.
What are the key properties of 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine?
1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine has a molecular weight of 338.28 g/mol, XLogP of 4.60, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[1-(3,4-dichlorophenyl)pyrazol-3-yl]propyl]piperidine is sourced from PubChem (CID 162119357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).