C17H22Cl3N3O2 — CID 67204666
4-[4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxybutyl]morpholine;hydrochloride (PubChem CID 67204666) has the molecular formula C17H22Cl3N3O2 and a molecular weight of 406.74 g/mol. Its IUPAC name is 4-[4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxybutyl]morpholine;hydrochloride.
| Compound Name | 4-[4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxybutyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 67204666 |
| Molecular Formula | C17H22Cl3N3O2 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 4-[4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxybutyl]morpholine;hydrochloride |
| SMILES | Cl.Clc1ccc(-n2ccc(OCCCCN3CCOCC3)n2)cc1Cl |
| InChI | InChI=1S/C17H21Cl2N3O2.ClH/c18-15-4-3-14(13-16(15)19)22-7-5-17(20-22)24-10-2-1-6-21-8-11-23-12-9-21;/h3-5,7,13H,1-2,6,8-12H2;1H |
| InChIKey | MEXVXHCRKVEZGI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|