C18H23Cl2N3O2 — CID 54673778
4-[2-[2-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]ethoxy]ethyl]morpholine (PubChem CID 54673778) has the molecular formula C18H23Cl2N3O2 and a molecular weight of 384.31 g/mol. Its IUPAC name is 4-[2-[2-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]ethoxy]ethyl]morpholine.
| Compound Name | 4-[2-[2-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]ethoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 54673778 |
| Molecular Formula | C18H23Cl2N3O2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 4-[2-[2-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]ethoxy]ethyl]morpholine |
| SMILES | Cc1cc(CCOCCN2CCOCC2)nn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H23Cl2N3O2/c1-14-12-15(4-8-24-9-5-22-6-10-25-11-7-22)21-23(14)16-2-3-17(19)18(20)13-16/h2-3,12-13H,4-11H2,1H3 |
| InChIKey | LGIPBJPYMXPPBX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|