C17H21Cl2N3O2 — CID 54673475
4-[2-[[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]methoxy]ethyl]morpholine (PubChem CID 54673475) has the molecular formula C17H21Cl2N3O2 and a molecular weight of 370.28 g/mol. Its IUPAC name is 4-[2-[[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]methoxy]ethyl]morpholine.
| Compound Name | 4-[2-[[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]methoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 54673475 |
| Molecular Formula | C17H21Cl2N3O2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-[2-[[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]methoxy]ethyl]morpholine |
| SMILES | Cc1cc(COCCN2CCOCC2)nn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H21Cl2N3O2/c1-13-10-14(12-24-9-6-21-4-7-23-8-5-21)20-22(13)15-2-3-16(18)17(19)11-15/h2-3,10-11H,4-9,12H2,1H3 |
| InChIKey | BHUHWTHYCJMUAM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|