C19H24Cl2N4O2 — CID 54673482
1-[4-[2-[[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]methoxy]ethyl]piperazin-1-yl]ethanone (PubChem CID 54673482) has the molecular formula C19H24Cl2N4O2 and a molecular weight of 411.33 g/mol. Its IUPAC name is 1-[4-[2-[[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]methoxy]ethyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]methoxy]ethyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 54673482 |
| Molecular Formula | C19H24Cl2N4O2 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 1-[4-[2-[[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]methoxy]ethyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CCOCc2cc(C)n(-c3ccc(Cl)c(Cl)c3)n2)CC1 |
| InChI | InChI=1S/C19H24Cl2N4O2/c1-14-11-16(22-25(14)17-3-4-18(20)19(21)12-17)13-27-10-9-23-5-7-24(8-6-23)15(2)26/h3-4,11-12H,5-10,13H2,1-2H3 |
| InChIKey | BCRJCZJYJXNRQO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|