C17H21Cl2N3O3 — CID 24739749
4-[2-[2-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxyethoxy]ethyl]morpholine (PubChem CID 24739749) has the molecular formula C17H21Cl2N3O3 and a molecular weight of 386.28 g/mol. Its IUPAC name is 4-[2-[2-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxyethoxy]ethyl]morpholine.
| Compound Name | 4-[2-[2-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxyethoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 24739749 |
| Molecular Formula | C17H21Cl2N3O3 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-[2-[2-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxyethoxy]ethyl]morpholine |
| SMILES | Clc1ccc(-n2ccc(OCCOCCN3CCOCC3)n2)cc1Cl |
| InChI | InChI=1S/C17H21Cl2N3O3/c18-15-2-1-14(13-16(15)19)22-4-3-17(20-22)25-12-11-24-10-7-21-5-8-23-9-6-21/h1-4,13H,5-12H2 |
| InChIKey | PUBTUBYIGOZPBV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|