C16H19Cl2N3O — CID 11667265
1-[2-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxyethyl]piperidine (PubChem CID 11667265) has the molecular formula C16H19Cl2N3O and a molecular weight of 340.25 g/mol. Its IUPAC name is 1-[2-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxyethyl]piperidine.
| Compound Name | 1-[2-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxyethyl]piperidine |
|---|---|
| PubChem CID | 11667265 |
| Molecular Formula | C16H19Cl2N3O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-[2-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxyethyl]piperidine |
| SMILES | Clc1ccc(-n2ccc(OCCN3CCCCC3)n2)cc1Cl |
| InChI | InChI=1S/C16H19Cl2N3O/c17-14-5-4-13(12-15(14)18)21-9-6-16(19-21)22-11-10-20-7-2-1-3-8-20/h4-6,9,12H,1-3,7-8,10-11H2 |
| InChIKey | PUZILSCHNRFUBL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |