C20H23Cl2N3O6 — CID 24743740
1-[1-[2-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxyethyl]piperidin-4-yl]ethanone;oxalic acid (PubChem CID 24743740) has the molecular formula C20H23Cl2N3O6 and a molecular weight of 472.33 g/mol. Its IUPAC name is 1-[1-[2-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxyethyl]piperidin-4-yl]ethanone;oxalic acid.
| Compound Name | 1-[1-[2-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxyethyl]piperidin-4-yl]ethanone;oxalic acid |
|---|---|
| PubChem CID | 24743740 |
| Molecular Formula | C20H23Cl2N3O6 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 1-[1-[2-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxyethyl]piperidin-4-yl]ethanone;oxalic acid |
| SMILES | CC(=O)C1CCN(CCOc2ccn(-c3ccc(Cl)c(Cl)c3)n2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H21Cl2N3O2.C2H2O4/c1-13(24)14-4-7-22(8-5-14)10-11-25-18-6-9-23(21-18)15-2-3-16(19)17(20)12-15;3-1(4)2(5)6/h2-3,6,9,12,14H,4-5,7-8,10-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | PLLFQEHZMRITDA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|