C20H26Cl2N4O5 — CID 91562464
1-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-3-(4-methylpiperazin-1-yl)propan-2-ol;2-oxopropanoic acid (PubChem CID 91562464) has the molecular formula C20H26Cl2N4O5 and a molecular weight of 473.36 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-3-(4-methylpiperazin-1-yl)propan-2-ol;2-oxopropanoic acid.
| Compound Name | 1-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-3-(4-methylpiperazin-1-yl)propan-2-ol;2-oxopropanoic acid |
|---|---|
| PubChem CID | 91562464 |
| Molecular Formula | C20H26Cl2N4O5 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-3-(4-methylpiperazin-1-yl)propan-2-ol;2-oxopropanoic acid |
| SMILES | CC(=O)C(=O)O.CN1CCN(CC(O)COc2ccn(-c3ccc(Cl)c(Cl)c3)n2)CC1 |
| InChI | InChI=1S/C17H22Cl2N4O2.C3H4O3/c1-21-6-8-22(9-7-21)11-14(24)12-25-17-4-5-23(20-17)13-2-3-15(18)16(19)10-13;1-2(4)3(5)6/h2-5,10,14,24H,6-9,11-12H2,1H3;1H3,(H,5,6) |
| InChIKey | NIFPIHAXQIOMJH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|