C17H21Cl2N3O — CID 11674772
1-(3,4-dichlorophenyl)-3-(4-pyrrolidin-1-ylbutoxy)pyrazole (PubChem CID 11674772) has the molecular formula C17H21Cl2N3O and a molecular weight of 354.28 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(4-pyrrolidin-1-ylbutoxy)pyrazole.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(4-pyrrolidin-1-ylbutoxy)pyrazole |
|---|---|
| PubChem CID | 11674772 |
| Molecular Formula | C17H21Cl2N3O |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(4-pyrrolidin-1-ylbutoxy)pyrazole |
| SMILES | Clc1ccc(-n2ccc(OCCCCN3CCCC3)n2)cc1Cl |
| InChI | InChI=1S/C17H21Cl2N3O/c18-15-6-5-14(13-16(15)19)22-11-7-17(20-22)23-12-4-3-10-21-8-1-2-9-21/h5-7,11,13H,1-4,8-10,12H2 |
| InChIKey | SMFVSSIDEBMGKS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|