C19H28ClNOS — CID 11681891
2-[(2-chlorophenyl)methylsulfanyl]-N-[(1S)-1-cyclohexylethyl]-2-methylpropanamide (PubChem CID 11681891) has the molecular formula C19H28ClNOS and a molecular weight of 353.96 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-N-[(1S)-1-cyclohexylethyl]-2-methylpropanamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-[(1S)-1-cyclohexylethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 11681891 |
| Molecular Formula | C19H28ClNOS |
| Molecular Weight | 353.96 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-[(1S)-1-cyclohexylethyl]-2-methylpropanamide |
| SMILES | C[C@H](NC(=O)C(C)(C)SCc1ccccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C19H28ClNOS/c1-14(15-9-5-4-6-10-15)21-18(22)19(2,3)23-13-16-11-7-8-12-17(16)20/h7-8,11-12,14-15H,4-6,9-10,13H2,1-3H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | VCYPYNIEECBFHT-AWEZNQCLSA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.96 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |