C11H11NO2 — CID 116822591
(2E,4E)-5-pyridin-3-ylhexa-2,4-dienoic acid (PubChem CID 116822591) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is (2E,4E)-5-pyridin-3-ylhexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-pyridin-3-ylhexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 116822591 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (2E,4E)-5-pyridin-3-ylhexa-2,4-dienoic acid |
| SMILES | C/C(=C\C=C\C(=O)O)c1cccnc1 |
| InChI | InChI=1S/C11H11NO2/c1-9(4-2-6-11(13)14)10-5-3-7-12-8-10/h2-8H,1H3,(H,13,14)/b6-2+,9-4+ |
| InChIKey | KKUKATLLUFRCEB-MXHAZWSOSA-N |
| XLogP | 2.13 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|