C10H12ClNOS — CID 116827682
5-chloro-2-methoxy-N,4-dimethylbenzenecarbothioamide (PubChem CID 116827682) has the molecular formula C10H12ClNOS and a molecular weight of 229.73 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N,4-dimethylbenzenecarbothioamide.
| Compound Name | 5-chloro-2-methoxy-N,4-dimethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 116827682 |
| Molecular Formula | C10H12ClNOS |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 5-chloro-2-methoxy-N,4-dimethylbenzenecarbothioamide |
| SMILES | CNC(=S)c1cc(Cl)c(C)cc1OC |
| InChI | InChI=1S/C10H12ClNOS/c1-6-4-9(13-3)7(5-8(6)11)10(14)12-2/h4-5H,1-3H3,(H,12,14) |
| InChIKey | FHVYAIFOYMOUII-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|