C11H15NO2S — CID 116827700
2,4-dimethoxy-N,3-dimethylbenzenecarbothioamide (PubChem CID 116827700) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2,4-dimethoxy-N,3-dimethylbenzenecarbothioamide.
| Compound Name | 2,4-dimethoxy-N,3-dimethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 116827700 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2,4-dimethoxy-N,3-dimethylbenzenecarbothioamide |
| SMILES | CNC(=S)c1ccc(OC)c(C)c1OC |
| InChI | InChI=1S/C11H15NO2S/c1-7-9(13-3)6-5-8(10(7)14-4)11(15)12-2/h5-6H,1-4H3,(H,12,15) |
| InChIKey | HUYOLRJXHYJWDN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|