C12H17NO2S — CID 116828013
methyl 2,4-dimethoxy-N,3-dimethylbenzenecarboximidothioate (PubChem CID 116828013) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is methyl 2,4-dimethoxy-N,3-dimethylbenzenecarboximidothioate.
| Compound Name | methyl 2,4-dimethoxy-N,3-dimethylbenzenecarboximidothioate |
|---|---|
| PubChem CID | 116828013 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | methyl 2,4-dimethoxy-N,3-dimethylbenzenecarboximidothioate |
| SMILES | C/N=C(\SC)c1ccc(OC)c(C)c1OC |
| InChI | InChI=1S/C12H17NO2S/c1-8-10(14-3)7-6-9(11(8)15-4)12(13-2)16-5/h6-7H,1-5H3/b13-12- |
| InChIKey | PSDLHQBRZJCYSU-SEYXRHQNSA-N |
| XLogP | 2.75 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|