C12H17NOS — CID 116828033
methyl 2-methoxy-N,4,6-trimethylbenzenecarboximidothioate (PubChem CID 116828033) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is methyl 2-methoxy-N,4,6-trimethylbenzenecarboximidothioate.
| Compound Name | methyl 2-methoxy-N,4,6-trimethylbenzenecarboximidothioate |
|---|---|
| PubChem CID | 116828033 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | methyl 2-methoxy-N,4,6-trimethylbenzenecarboximidothioate |
| SMILES | C/N=C(\SC)c1c(C)cc(C)cc1OC |
| InChI | InChI=1S/C12H17NOS/c1-8-6-9(2)11(10(7-8)14-4)12(13-3)15-5/h6-7H,1-5H3/b13-12- |
| InChIKey | QLSMVDQUFAZBEC-SEYXRHQNSA-N |
| XLogP | 3.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|