C10H14N2O3 — CID 19437932
N'-hydroxy-2,6-dimethoxy-4-methylbenzenecarboximidamide (PubChem CID 19437932) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is N'-hydroxy-2,6-dimethoxy-4-methylbenzenecarboximidamide.
| Compound Name | N'-hydroxy-2,6-dimethoxy-4-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 19437932 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | N'-hydroxy-2,6-dimethoxy-4-methylbenzenecarboximidamide |
| SMILES | COc1cc(C)cc(OC)c1/C(N)=N/O |
| InChI | InChI=1S/C10H14N2O3/c1-6-4-7(14-2)9(10(11)12-13)8(5-6)15-3/h4-5,13H,1-3H3,(H2,11,12) |
| InChIKey | HSOFIXJUJJNHDK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|