C11H15NO2 — CID 135979265
2-(C,N-dimethylcarbonimidoyl)-3-methoxy-5-methylphenol (PubChem CID 135979265) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(C,N-dimethylcarbonimidoyl)-3-methoxy-5-methylphenol.
| Compound Name | 2-(C,N-dimethylcarbonimidoyl)-3-methoxy-5-methylphenol |
|---|---|
| PubChem CID | 135979265 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(C,N-dimethylcarbonimidoyl)-3-methoxy-5-methylphenol |
| SMILES | C/N=C(\C)c1c(O)cc(C)cc1OC |
| InChI | InChI=1S/C11H15NO2/c1-7-5-9(13)11(8(2)12-3)10(6-7)14-4/h5-6,13H,1-4H3/b12-8+ |
| InChIKey | SXEKPNPIBXXKIV-XYOKQWHBSA-N |
| XLogP | 2.15 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|