C15H14FNO2 — CID 116837207
3-(5-fluoro-2-methoxyphenyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 116837207) has the molecular formula C15H14FNO2 and a molecular weight of 259.28 g/mol. Its IUPAC name is 3-(5-fluoro-2-methoxyphenyl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 3-(5-fluoro-2-methoxyphenyl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 116837207 |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-(5-fluoro-2-methoxyphenyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | COc1ccc(F)cc1C1COc2ccccc2N1 |
| InChI | InChI=1S/C15H14FNO2/c1-18-14-7-6-10(16)8-11(14)13-9-19-15-5-3-2-4-12(15)17-13/h2-8,13,17H,9H2,1H3 |
| InChIKey | JCGCNNDSLHGNSY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |