C17H15FN2O2 — CID 167449607
N-[4-(3,4-dihydro-2H-1,4-benzoxazin-3-yl)-3-fluorophenyl]prop-2-enamide (PubChem CID 167449607) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-2H-1,4-benzoxazin-3-yl)-3-fluorophenyl]prop-2-enamide.
| Compound Name | N-[4-(3,4-dihydro-2H-1,4-benzoxazin-3-yl)-3-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167449607 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-[4-(3,4-dihydro-2H-1,4-benzoxazin-3-yl)-3-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(C2COc3ccccc3N2)c(F)c1 |
| InChI | InChI=1S/C17H15FN2O2/c1-2-17(21)19-11-7-8-12(13(18)9-11)15-10-22-16-6-4-3-5-14(16)20-15/h2-9,15,20H,1,10H2,(H,19,21) |
| InChIKey | DSIRRVOKODPBEJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|