C22H23FN6O2 — CID 163980895
N-[3-[[2-(3,4-dihydro-2H-1,4-benzoxazin-6-ylamino)-5-fluoro-2-methyl-1H-pyrimidin-6-yl]amino]phenyl]prop-2-enamide (PubChem CID 163980895) has the molecular formula C22H23FN6O2 and a molecular weight of 422.46 g/mol. Its IUPAC name is N-[3-[[2-(3,4-dihydro-2H-1,4-benzoxazin-6-ylamino)-5-fluoro-2-methyl-1H-pyrimidin-6-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-(3,4-dihydro-2H-1,4-benzoxazin-6-ylamino)-5-fluoro-2-methyl-1H-pyrimidin-6-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 163980895 |
| Molecular Formula | C22H23FN6O2 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | N-[3-[[2-(3,4-dihydro-2H-1,4-benzoxazin-6-ylamino)-5-fluoro-2-methyl-1H-pyrimidin-6-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(NC2=C(F)C=NC(C)(Nc3ccc4c(c3)NCCO4)N2)c1 |
| InChI | InChI=1S/C22H23FN6O2/c1-3-20(30)26-14-5-4-6-15(11-14)27-21-17(23)13-25-22(2,29-21)28-16-7-8-19-18(12-16)24-9-10-31-19/h3-8,11-13,24,27-29H,1,9-10H2,2H3,(H,26,30) |
| InChIKey | WUNQLZUKTWWRKB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 98.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|