C13H18F2 — CID 116841250
3-(1,1-difluoropropyl)-1,2,4,5-tetramethylbenzene (PubChem CID 116841250) has the molecular formula C13H18F2 and a molecular weight of 212.28 g/mol. Its IUPAC name is 3-(1,1-difluoropropyl)-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-(1,1-difluoropropyl)-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 116841250 |
| Molecular Formula | C13H18F2 |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 3-(1,1-difluoropropyl)-1,2,4,5-tetramethylbenzene |
| SMILES | CCC(F)(F)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C13H18F2/c1-6-13(14,15)12-10(4)8(2)7-9(3)11(12)5/h7H,6H2,1-5H3 |
| InChIKey | MFNNWGKFKZLAEL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |