About N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine
N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine (PubChem CID 82283215) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine.
Analyze N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine?
The IUPAC name of N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine (CID 82283215) is N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine.
What is the SMILES notation for N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine?
The canonical SMILES for N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine is CNC(C)(C)c1c(C)c(C)cc(C)c1C.
What is the InChIKey of N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine?
The InChIKey is RXZFABGUUARNJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N/c1-9-8-10(2)12(4)13(11(9)3)14(5,6)15-7/h8,15H,1-7H3.
What are the key properties of N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine?
N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine has a molecular weight of 205.34 g/mol, XLogP of 3.37, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(2,3,5,6-tetramethylphenyl)propan-2-amine is sourced from PubChem (CID 82283215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).