C12H14ClFN2O — CID 116848348
1-(3-chloro-4-fluorophenyl)-N',N'-dimethylcyclopropane-1-carbohydrazide (PubChem CID 116848348) has the molecular formula C12H14ClFN2O and a molecular weight of 256.71 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N',N'-dimethylcyclopropane-1-carbohydrazide.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N',N'-dimethylcyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 116848348 |
| Molecular Formula | C12H14ClFN2O |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N',N'-dimethylcyclopropane-1-carbohydrazide |
| SMILES | CN(C)NC(=O)C1(c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C12H14ClFN2O/c1-16(2)15-11(17)12(5-6-12)8-3-4-10(14)9(13)7-8/h3-4,7H,5-6H2,1-2H3,(H,15,17) |
| InChIKey | XSHYKTQJOOFJDS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|