C8H14N4O — CID 116849541
2-amino-N'-methyl-3-(1H-pyrrol-2-yl)propanehydrazide (PubChem CID 116849541) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-amino-N'-methyl-3-(1H-pyrrol-2-yl)propanehydrazide.
| Compound Name | 2-amino-N'-methyl-3-(1H-pyrrol-2-yl)propanehydrazide |
|---|---|
| PubChem CID | 116849541 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-amino-N'-methyl-3-(1H-pyrrol-2-yl)propanehydrazide |
| SMILES | CNNC(=O)C(N)Cc1ccc[nH]1 |
| InChI | InChI=1S/C8H14N4O/c1-10-12-8(13)7(9)5-6-3-2-4-11-6/h2-4,7,10-11H,5,9H2,1H3,(H,12,13) |
| InChIKey | NJMJWDJWQQEVMH-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|