C28H33N5O5 — CID 11685017
N-[4-[[4-(dimethylamino)-6-methyl-2-pyridinyl]amino]cyclohexyl]-2-(4-methoxyphenoxy)-5-nitrobenzamide (PubChem CID 11685017) has the molecular formula C28H33N5O5 and a molecular weight of 519.60 g/mol. Its IUPAC name is N-[4-[[4-(dimethylamino)-6-methyl-2-pyridinyl]amino]cyclohexyl]-2-(4-methoxyphenoxy)-5-nitrobenzamide.
| Compound Name | N-[4-[[4-(dimethylamino)-6-methyl-2-pyridinyl]amino]cyclohexyl]-2-(4-methoxyphenoxy)-5-nitrobenzamide |
|---|---|
| PubChem CID | 11685017 |
| Molecular Formula | C28H33N5O5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | N-[4-[[4-(dimethylamino)-6-methyl-2-pyridinyl]amino]cyclohexyl]-2-(4-methoxyphenoxy)-5-nitrobenzamide |
| SMILES | COc1ccc(Oc2ccc([N+](=O)[O-])cc2C(=O)NC2CCC(Nc3cc(N(C)C)cc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C28H33N5O5/c1-18-15-22(32(2)3)17-27(29-18)30-19-5-7-20(8-6-19)31-28(34)25-16-21(33(35)36)9-14-26(25)38-24-12-10-23(37-4)11-13-24/h9-17,19-20H,5-8H2,1-4H3,(H,29,30)(H,31,34) |
| InChIKey | XWHDKDDKUIMCMD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|