C12H16N2O — CID 116851261
3-amino-3-(2-methoxy-4,6-dimethylphenyl)propanenitrile (PubChem CID 116851261) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-amino-3-(2-methoxy-4,6-dimethylphenyl)propanenitrile.
| Compound Name | 3-amino-3-(2-methoxy-4,6-dimethylphenyl)propanenitrile |
|---|---|
| PubChem CID | 116851261 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-amino-3-(2-methoxy-4,6-dimethylphenyl)propanenitrile |
| SMILES | COc1cc(C)cc(C)c1C(N)CC#N |
| InChI | InChI=1S/C12H16N2O/c1-8-6-9(2)12(10(14)4-5-13)11(7-8)15-3/h6-7,10H,4,14H2,1-3H3 |
| InChIKey | DESOXAPSQFCZFN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |