C11H11NO3S — CID 116852886
3-[(2-methyl-1,3-benzoxazol-5-yl)sulfanyl]propanoic acid (PubChem CID 116852886) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-benzoxazol-5-yl)sulfanyl]propanoic acid.
| Compound Name | 3-[(2-methyl-1,3-benzoxazol-5-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 116852886 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 3-[(2-methyl-1,3-benzoxazol-5-yl)sulfanyl]propanoic acid |
| SMILES | Cc1nc2cc(SCCC(=O)O)ccc2o1 |
| InChI | InChI=1S/C11H11NO3S/c1-7-12-9-6-8(2-3-10(9)15-7)16-5-4-11(13)14/h2-3,6H,4-5H2,1H3,(H,13,14) |
| InChIKey | QHRODZHNZOAEDR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |