C11H12N2O5S — CID 43361826
3-[(2-methyl-1,3-benzoxazol-5-yl)sulfamoyl]propanoic acid (PubChem CID 43361826) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-benzoxazol-5-yl)sulfamoyl]propanoic acid.
| Compound Name | 3-[(2-methyl-1,3-benzoxazol-5-yl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 43361826 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 3-[(2-methyl-1,3-benzoxazol-5-yl)sulfamoyl]propanoic acid |
| SMILES | Cc1nc2cc(NS(=O)(=O)CCC(=O)O)ccc2o1 |
| InChI | InChI=1S/C11H12N2O5S/c1-7-12-9-6-8(2-3-10(9)18-7)13-19(16,17)5-4-11(14)15/h2-3,6,13H,4-5H2,1H3,(H,14,15) |
| InChIKey | IXEZQBLPOVBKGV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |