C10H13BrFNO2S — CID 116855220
2-(5-bromo-2-fluorophenyl)sulfonyl-2-methylpropan-1-amine (PubChem CID 116855220) has the molecular formula C10H13BrFNO2S and a molecular weight of 310.19 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)sulfonyl-2-methylpropan-1-amine.
| Compound Name | 2-(5-bromo-2-fluorophenyl)sulfonyl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 116855220 |
| Molecular Formula | C10H13BrFNO2S |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)sulfonyl-2-methylpropan-1-amine |
| SMILES | CC(C)(CN)S(=O)(=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C10H13BrFNO2S/c1-10(2,6-13)16(14,15)9-5-7(11)3-4-8(9)12/h3-5H,6,13H2,1-2H3 |
| InChIKey | MEANMFOJTXMNRI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |