C12H13BrO4S — CID 116855387
1-(5-bromo-2-methylphenyl)sulfonylcyclobutane-1-carboxylic acid (PubChem CID 116855387) has the molecular formula C12H13BrO4S and a molecular weight of 333.20 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)sulfonylcyclobutane-1-carboxylic acid.
| Compound Name | 1-(5-bromo-2-methylphenyl)sulfonylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 116855387 |
| Molecular Formula | C12H13BrO4S |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)sulfonylcyclobutane-1-carboxylic acid |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)C1(C(=O)O)CCC1 |
| InChI | InChI=1S/C12H13BrO4S/c1-8-3-4-9(13)7-10(8)18(16,17)12(11(14)15)5-2-6-12/h3-4,7H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | UVGWARHGEWDNIQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |