C7H13N3 — CID 116855697
N-methyl-1-(1H-pyrrol-3-yl)ethane-1,2-diamine (PubChem CID 116855697) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is N-methyl-1-(1H-pyrrol-3-yl)ethane-1,2-diamine.
| Compound Name | N-methyl-1-(1H-pyrrol-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116855697 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | N-methyl-1-(1H-pyrrol-3-yl)ethane-1,2-diamine |
| SMILES | CNC(CN)c1cc[nH]c1 |
| InChI | InChI=1S/C7H13N3/c1-9-7(4-8)6-2-3-10-5-6/h2-3,5,7,9-10H,4,8H2,1H3 |
| InChIKey | KIJPXFZALFHFQO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |