C10H19N3 — CID 116949458
N,N'-dimethyl-1-(1H-pyrrol-3-yl)butane-1,4-diamine (PubChem CID 116949458) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is N,N'-dimethyl-1-(1H-pyrrol-3-yl)butane-1,4-diamine.
| Compound Name | N,N'-dimethyl-1-(1H-pyrrol-3-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116949458 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N,N'-dimethyl-1-(1H-pyrrol-3-yl)butane-1,4-diamine |
| SMILES | CNCCCC(NC)c1cc[nH]c1 |
| InChI | InChI=1S/C10H19N3/c1-11-6-3-4-10(12-2)9-5-7-13-8-9/h5,7-8,10-13H,3-4,6H2,1-2H3 |
| InChIKey | LRYRPTWNGRXYMU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|