C11H21N3 — CID 116905271
N,N,N'-trimethyl-1-(1H-pyrrol-3-yl)butane-1,4-diamine (PubChem CID 116905271) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is N,N,N'-trimethyl-1-(1H-pyrrol-3-yl)butane-1,4-diamine.
| Compound Name | N,N,N'-trimethyl-1-(1H-pyrrol-3-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116905271 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N,N,N'-trimethyl-1-(1H-pyrrol-3-yl)butane-1,4-diamine |
| SMILES | CNCCCC(c1cc[nH]c1)N(C)C |
| InChI | InChI=1S/C11H21N3/c1-12-7-4-5-11(14(2)3)10-6-8-13-9-10/h6,8-9,11-13H,4-5,7H2,1-3H3 |
| InChIKey | KGLAZCLDSYGMPN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|