C16H25N3 — CID 116905269
N,N,N'-trimethyl-1-(2-methyl-1H-indol-3-yl)butane-1,4-diamine (PubChem CID 116905269) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is N,N,N'-trimethyl-1-(2-methyl-1H-indol-3-yl)butane-1,4-diamine.
| Compound Name | N,N,N'-trimethyl-1-(2-methyl-1H-indol-3-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116905269 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | N,N,N'-trimethyl-1-(2-methyl-1H-indol-3-yl)butane-1,4-diamine |
| SMILES | CNCCCC(c1c(C)[nH]c2ccccc12)N(C)C |
| InChI | InChI=1S/C16H25N3/c1-12-16(13-8-5-6-9-14(13)18-12)15(19(3)4)10-7-11-17-2/h5-6,8-9,15,17-18H,7,10-11H2,1-4H3 |
| InChIKey | GZPNFEXDMQYQJM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|