C16H20N4 — CID 116876967
N-methyl-3-[5-(2-methyl-1H-indol-3-yl)-1H-imidazol-2-yl]propan-1-amine (PubChem CID 116876967) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-methyl-3-[5-(2-methyl-1H-indol-3-yl)-1H-imidazol-2-yl]propan-1-amine.
| Compound Name | N-methyl-3-[5-(2-methyl-1H-indol-3-yl)-1H-imidazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 116876967 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N-methyl-3-[5-(2-methyl-1H-indol-3-yl)-1H-imidazol-2-yl]propan-1-amine |
| SMILES | CNCCCc1ncc(-c2c(C)[nH]c3ccccc23)[nH]1 |
| InChI | InChI=1S/C16H20N4/c1-11-16(12-6-3-4-7-13(12)19-11)14-10-18-15(20-14)8-5-9-17-2/h3-4,6-7,10,17,19H,5,8-9H2,1-2H3,(H,18,20) |
| InChIKey | HRWOBASFPFTVLZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|