C13H15F2N3 — CID 54924865
3-[5-(2,6-difluorophenyl)-1H-imidazol-2-yl]-N-methylpropan-1-amine (PubChem CID 54924865) has the molecular formula C13H15F2N3 and a molecular weight of 251.28 g/mol. Its IUPAC name is 3-[5-(2,6-difluorophenyl)-1H-imidazol-2-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[5-(2,6-difluorophenyl)-1H-imidazol-2-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 54924865 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-[5-(2,6-difluorophenyl)-1H-imidazol-2-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCc1ncc(-c2c(F)cccc2F)[nH]1 |
| InChI | InChI=1S/C13H15F2N3/c1-16-7-3-6-12-17-8-11(18-12)13-9(14)4-2-5-10(13)15/h2,4-5,8,16H,3,6-7H2,1H3,(H,17,18) |
| InChIKey | PAODARWRUSLFNQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|