C14H17F2N3O — CID 60842087
3-[5-[2-(difluoromethoxy)phenyl]-1H-imidazol-2-yl]-N-methylpropan-1-amine (PubChem CID 60842087) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-[5-[2-(difluoromethoxy)phenyl]-1H-imidazol-2-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[5-[2-(difluoromethoxy)phenyl]-1H-imidazol-2-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 60842087 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3-[5-[2-(difluoromethoxy)phenyl]-1H-imidazol-2-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCc1ncc(-c2ccccc2OC(F)F)[nH]1 |
| InChI | InChI=1S/C14H17F2N3O/c1-17-8-4-7-13-18-9-11(19-13)10-5-2-3-6-12(10)20-14(15)16/h2-3,5-6,9,14,17H,4,7-8H2,1H3,(H,18,19) |
| InChIKey | JLKFTJBCLTUDRG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|