C9H15N3 — CID 116961220
1-[methylamino(1H-pyrrol-3-yl)methyl]cyclopropan-1-amine (PubChem CID 116961220) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-[methylamino(1H-pyrrol-3-yl)methyl]cyclopropan-1-amine.
| Compound Name | 1-[methylamino(1H-pyrrol-3-yl)methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 116961220 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1-[methylamino(1H-pyrrol-3-yl)methyl]cyclopropan-1-amine |
| SMILES | CNC(c1cc[nH]c1)C1(N)CC1 |
| InChI | InChI=1S/C9H15N3/c1-11-8(9(10)3-4-9)7-2-5-12-6-7/h2,5-6,8,11-12H,3-4,10H2,1H3 |
| InChIKey | BQANFEFTKUAVFN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |