C9H11N3O2 — CID 116856134
5-methyl-5-(1H-pyrrol-2-yl)piperazine-2,3-dione (PubChem CID 116856134) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 5-methyl-5-(1H-pyrrol-2-yl)piperazine-2,3-dione.
| Compound Name | 5-methyl-5-(1H-pyrrol-2-yl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 116856134 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 5-methyl-5-(1H-pyrrol-2-yl)piperazine-2,3-dione |
| SMILES | CC1(c2ccc[nH]2)CNC(=O)C(=O)N1 |
| InChI | InChI=1S/C9H11N3O2/c1-9(6-3-2-4-10-6)5-11-7(13)8(14)12-9/h2-4,10H,5H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | GTUSBYLUJWBIQV-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|