C11H14N4 — CID 116862724
6-amino-2-cyclohexylpyrimidine-4-carbonitrile (PubChem CID 116862724) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 6-amino-2-cyclohexylpyrimidine-4-carbonitrile.
| Compound Name | 6-amino-2-cyclohexylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 116862724 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 6-amino-2-cyclohexylpyrimidine-4-carbonitrile |
| SMILES | N#Cc1cc(N)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C11H14N4/c12-7-9-6-10(13)15-11(14-9)8-4-2-1-3-5-8/h6,8H,1-5H2,(H2,13,14,15) |
| InChIKey | VYSIJSWNZJZVPJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |